C12H15NO2 — CID 134965532
[(4R)-4-ethyl-2-phenyl-5H-1,3-oxazol-4-yl]methanol (PubChem CID 134965532) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is [(4R)-4-ethyl-2-phenyl-5H-1,3-oxazol-4-yl]methanol.
| Compound Name | [(4R)-4-ethyl-2-phenyl-5H-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 134965532 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | [(4R)-4-ethyl-2-phenyl-5H-1,3-oxazol-4-yl]methanol |
| SMILES | CC[C@@]1(CO)COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C12H15NO2/c1-2-12(8-14)9-15-11(13-12)10-6-4-3-5-7-10/h3-7,14H,2,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | UBBITZJUAPCBRF-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |