C18H19NO — CID 13496559
2,3-diphenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole (PubChem CID 13496559) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2,3-diphenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole.
| Compound Name | 2,3-diphenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 13496559 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2,3-diphenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole |
| SMILES | c1ccc(C2OC3CCCN3C2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO/c1-3-8-14(9-4-1)17-18(15-10-5-2-6-11-15)20-16-12-7-13-19(16)17/h1-6,8-11,16-18H,7,12-13H2 |
| InChIKey | LQHYEYCOOMHOTD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |