C13H19LiO2Si — CID 134965765
lithium [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane (PubChem CID 134965765) has the molecular formula C13H19LiO2Si and a molecular weight of 242.32 g/mol. Its IUPAC name is lithium [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane.
| Compound Name | lithium [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134965765 |
| Molecular Formula | C13H19LiO2Si |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | lithium [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane |
| SMILES | [C-]#CC1=C[C@H]([Si](C)(C)C)[C@H]2OC(C)(C)O[C@@H]12.[Li+] |
| InChI | InChI=1S/C13H19O2Si.Li/c1-7-9-8-10(16(4,5)6)12-11(9)14-13(2,3)15-12;/h8,10-12H,2-6H3;/q-1;+1/t10-,11-,12+;/m0./s1 |
| InChIKey | DZZSWCIIMPKRAK-AHBISNNASA-N |
| XLogP | -0.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|