C16H17NO2 — CID 134965797
(4S)-4-[(3R,4E)-hexa-1,4-dien-3-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one (PubChem CID 134965797) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (4S)-4-[(3R,4E)-hexa-1,4-dien-3-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4S)-4-[(3R,4E)-hexa-1,4-dien-3-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 134965797 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (4S)-4-[(3R,4E)-hexa-1,4-dien-3-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one |
| SMILES | C=C[C@H](/C=C/C)[C@]1(C)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C16H17NO2/c1-4-9-13(5-2)16(3)15(18)19-14(17-16)12-10-7-6-8-11-12/h4-11,13H,2H2,1,3H3/b9-4+/t13-,16+/m1/s1 |
| InChIKey | ZADBMTKDLTUHAX-XEUXXXKASA-N |
| XLogP | 3.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|