C11H10O4 — CID 134965802
(1S,9R)-5-methyl-4,8,12-trioxatricyclo[7.4.0.02,7]trideca-2(7),5,10-trien-3-one (PubChem CID 134965802) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is (1S,9R)-5-methyl-4,8,12-trioxatricyclo[7.4.0.02,7]trideca-2(7),5,10-trien-3-one.
| Compound Name | (1S,9R)-5-methyl-4,8,12-trioxatricyclo[7.4.0.02,7]trideca-2(7),5,10-trien-3-one |
|---|---|
| PubChem CID | 134965802 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (1S,9R)-5-methyl-4,8,12-trioxatricyclo[7.4.0.02,7]trideca-2(7),5,10-trien-3-one |
| SMILES | Cc1cc2c(c(=O)o1)[C@H]1COC=C[C@@H]1O2 |
| InChI | InChI=1S/C11H10O4/c1-6-4-9-10(11(12)14-6)7-5-13-3-2-8(7)15-9/h2-4,7-8H,5H2,1H3/t7-,8-/m0/s1 |
| InChIKey | ZCFKXCVUKFIZPL-YUMQZZPRSA-N |
| XLogP | 1.34 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |