C12H18Cl2N2 — CID 134965891
2,5-bis[(2S)-butan-2-yl]-3,6-dichloropyrazine (PubChem CID 134965891) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 2,5-bis[(2S)-butan-2-yl]-3,6-dichloropyrazine.
| Compound Name | 2,5-bis[(2S)-butan-2-yl]-3,6-dichloropyrazine |
|---|---|
| PubChem CID | 134965891 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2,5-bis[(2S)-butan-2-yl]-3,6-dichloropyrazine |
| SMILES | CC[C@H](C)c1nc(Cl)c([C@@H](C)CC)nc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-5-7(3)9-11(13)16-10(8(4)6-2)12(14)15-9/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | AEOUMSXCGUVSJD-YUMQZZPRSA-N |
| XLogP | 4.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |