About 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan
5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan (PubChem CID 134965937) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan.
Molecular Properties
| Compound Name | 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan |
| PubChem CID | 134965937 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan |
| SMILES | CC[C@H]1CC[C@H](C2=CC(C)(C)CO2)O1 |
| InChI | InChI=1S/C12H20O2/c1-4-9-5-6-10(14-9)11-7-12(2,3)8-13-11/h7,9-10H,4-6,8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | YWACSIBKICBKPI-VHSXEESVSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan?
The IUPAC name of 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan (CID 134965937) is 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan.
What is the SMILES notation for 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan?
The canonical SMILES for 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan is CC[C@H]1CC[C@H](C2=CC(C)(C)CO2)O1.
What is the InChIKey of 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan?
The InChIKey is YWACSIBKICBKPI-VHSXEESVSA-N. The full InChI is InChI=1S/C12H20O2/c1-4-9-5-6-10(14-9)11-7-12(2,3)8-13-11/h7,9-10H,4-6,8H2,1-3H3/t9-,10+/m0/s1.
What are the key properties of 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan?
5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan has a molecular weight of 196.29 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,5S)-5-ethyloxolan-2-yl]-3,3-dimethyl-2H-furan is sourced from PubChem (CID 134965937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).