C24H42OSi2 — CID 134966075
4-[(3aS)-6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5-dihydro-2H-inden-3a-yl]but-1-ynyl-trimethylsilane (PubChem CID 134966075) has the molecular formula C24H42OSi2 and a molecular weight of 402.77 g/mol. Its IUPAC name is 4-[(3aS)-6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5-dihydro-2H-inden-3a-yl]but-1-ynyl-trimethylsilane.
| Compound Name | 4-[(3aS)-6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5-dihydro-2H-inden-3a-yl]but-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 134966075 |
| Molecular Formula | C24H42OSi2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 4-[(3aS)-6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5-dihydro-2H-inden-3a-yl]but-1-ynyl-trimethylsilane |
| SMILES | CC1(C)CC(O[Si](C)(C)C(C)(C)C)=CC2=CCC[C@@]21CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C24H42OSi2/c1-22(2,3)27(9,10)25-21-18-20-14-13-16-24(20,23(4,5)19-21)15-11-12-17-26(6,7)8/h14,18H,11,13,15-16,19H2,1-10H3/t24-/m0/s1 |
| InChIKey | WTDVPKUZUVIMOD-DEOSSOPVSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|