C8H10O2 — CID 134966099
(4R)-4-prop-2-enyl-3,4-dihydropyran-2-one (PubChem CID 134966099) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (4R)-4-prop-2-enyl-3,4-dihydropyran-2-one.
| Compound Name | (4R)-4-prop-2-enyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 134966099 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (4R)-4-prop-2-enyl-3,4-dihydropyran-2-one |
| SMILES | C=CC[C@H]1C=COC(=O)C1 |
| InChI | InChI=1S/C8H10O2/c1-2-3-7-4-5-10-8(9)6-7/h2,4-5,7H,1,3,6H2/t7-/m0/s1 |
| InChIKey | UXXIMYZSDUUDEY-ZETCQYMHSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|