C16H36OSi — CID 134966102
tert-butyl-(2,2-dimethyloctoxy)-dimethylsilane (PubChem CID 134966102) has the molecular formula C16H36OSi and a molecular weight of 272.55 g/mol. Its IUPAC name is tert-butyl-(2,2-dimethyloctoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2,2-dimethyloctoxy)-dimethylsilane |
|---|---|
| PubChem CID | 134966102 |
| Molecular Formula | C16H36OSi |
| Molecular Weight | 272.55 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | tert-butyl-(2,2-dimethyloctoxy)-dimethylsilane |
| SMILES | CCCCCCC(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36OSi/c1-9-10-11-12-13-16(5,6)14-17-18(7,8)15(2,3)4/h9-14H2,1-8H3 |
| InChIKey | RIJWTKLOCXRURZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|