C13H24O — CID 134966105
(4S)-4-ethyl-2,7,7-trimethyloct-5-yn-4-ol (PubChem CID 134966105) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (4S)-4-ethyl-2,7,7-trimethyloct-5-yn-4-ol.
| Compound Name | (4S)-4-ethyl-2,7,7-trimethyloct-5-yn-4-ol |
|---|---|
| PubChem CID | 134966105 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (4S)-4-ethyl-2,7,7-trimethyloct-5-yn-4-ol |
| SMILES | CC[C@@](O)(C#CC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C13H24O/c1-7-13(14,10-11(2)3)9-8-12(4,5)6/h11,14H,7,10H2,1-6H3/t13-/m1/s1 |
| InChIKey | WVVXDEMDNBYZSX-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|