C15H17NO — CID 134966119
(8R,10aS)-8-ethenyl-9,10-dimethyl-7,8-dihydro-3H-pyrrolo[2,1-i]indol-5-one (PubChem CID 134966119) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (8R,10aS)-8-ethenyl-9,10-dimethyl-7,8-dihydro-3H-pyrrolo[2,1-i]indol-5-one.
| Compound Name | (8R,10aS)-8-ethenyl-9,10-dimethyl-7,8-dihydro-3H-pyrrolo[2,1-i]indol-5-one |
|---|---|
| PubChem CID | 134966119 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (8R,10aS)-8-ethenyl-9,10-dimethyl-7,8-dihydro-3H-pyrrolo[2,1-i]indol-5-one |
| SMILES | C=C[C@H]1CC2=CC(=O)N3CC=C[C@@]23C(C)=C1C |
| InChI | InChI=1S/C15H17NO/c1-4-12-8-13-9-14(17)16-7-5-6-15(13,16)11(3)10(12)2/h4-6,9,12H,1,7-8H2,2-3H3/t12-,15+/m0/s1 |
| InChIKey | QHHLGMWWXSRFHC-SWLSCSKDSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|