About [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium
[(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium (PubChem CID 134966143) has the molecular formula C8H15NpO2-
and a molecular weight of 381.21 g/mol. Its IUPAC name is [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium.
Molecular Properties
| Compound Name | [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium |
| PubChem CID | 134966143 |
| Molecular Formula | C8H15NpO2- |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium |
| SMILES | [2H][C@H](C)[CH-]OC(=O)C(C)(C)C.[Np] |
| InChI | InChI=1S/C8H15O2.Np/c1-5-6-10-7(9)8(2,3)4;/h6H,5H2,1-4H3;/q-1;/i5D;/t5-;/m1./s1 |
| InChIKey | IKFZXRMOCGKJPU-HRQKYMAYSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium?
The IUPAC name of [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium (CID 134966143) is [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium.
What is the SMILES notation for [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium?
The canonical SMILES for [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium is [2H][C@H](C)[CH-]OC(=O)C(C)(C)C.[Np].
What is the InChIKey of [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium?
The InChIKey is IKFZXRMOCGKJPU-HRQKYMAYSA-N. The full InChI is InChI=1S/C8H15O2.Np/c1-5-6-10-7(9)8(2,3)4;/h6H,5H2,1-4H3;/q-1;/i5D;/t5-;/m1./s1.
What are the key properties of [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium?
[(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium has a molecular weight of 381.21 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-deuteriopropyl] 2,2-dimethylpropanoate;neptunium is sourced from PubChem (CID 134966143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).