C12H20N2O4 — CID 134966211
tert-butyl N-[2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]ethyl]carbamate (PubChem CID 134966211) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl N-[2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 134966211 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | tert-butyl N-[2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]ethyl]carbamate |
| SMILES | C=C[C@H]1OC(=O)N[C@@H]1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-5-9-8(14-11(16)17-9)6-7-13-10(15)18-12(2,3)4/h5,8-9H,1,6-7H2,2-4H3,(H,13,15)(H,14,16)/t8-,9-/m1/s1 |
| InChIKey | NFIZYKPGDJYGHP-RKDXNWHRSA-N |
| XLogP | 1.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|