C14H27NO4 — CID 134966400
(4S)-4-[(1S,2S)-1,2-dihydroxy-2-methylheptyl]-6,6-dimethyl-1,3-oxazinan-2-one (PubChem CID 134966400) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is (4S)-4-[(1S,2S)-1,2-dihydroxy-2-methylheptyl]-6,6-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-[(1S,2S)-1,2-dihydroxy-2-methylheptyl]-6,6-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 134966400 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | (4S)-4-[(1S,2S)-1,2-dihydroxy-2-methylheptyl]-6,6-dimethyl-1,3-oxazinan-2-one |
| SMILES | CCCCC[C@](C)(O)[C@@H](O)[C@@H]1CC(C)(C)OC(=O)N1 |
| InChI | InChI=1S/C14H27NO4/c1-5-6-7-8-14(4,18)11(16)10-9-13(2,3)19-12(17)15-10/h10-11,16,18H,5-9H2,1-4H3,(H,15,17)/t10-,11-,14-/m0/s1 |
| InChIKey | IJLTVQJEAAAKDJ-MJVIPROJSA-N |
| XLogP | 1.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|