C10H25N2+ — CID 134966540
[(2S)-2-amino-3,3-dimethylbutyl]-diethylazanium (PubChem CID 134966540) has the molecular formula C10H25N2+ and a molecular weight of 173.32 g/mol. Its IUPAC name is [(2S)-2-amino-3,3-dimethylbutyl]-diethylazanium.
| Compound Name | [(2S)-2-amino-3,3-dimethylbutyl]-diethylazanium |
|---|---|
| PubChem CID | 134966540 |
| Molecular Formula | C10H25N2+ |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.20 |
| IUPAC Name | [(2S)-2-amino-3,3-dimethylbutyl]-diethylazanium |
| SMILES | CC[NH+](CC)C[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C10H24N2/c1-6-12(7-2)8-9(11)10(3,4)5/h9H,6-8,11H2,1-5H3/p+1/t9-/m1/s1 |
| InChIKey | TWSWWTQEYGSYFZ-SECBINFHSA-O |
| XLogP | 0.28 |
| TPSA | 30.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |