About N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine
N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine (PubChem CID 134966651) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine |
| PubChem CID | 134966651 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine |
| SMILES | C/C=C/C1=CC(NC(C)C)=CCC1 |
| InChI | InChI=1S/C12H19N/c1-4-6-11-7-5-8-12(9-11)13-10(2)3/h4,6,8-10,13H,5,7H2,1-3H3/b6-4+ |
| InChIKey | SFTQRGCWSITWRI-GQCTYLIASA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine?
The IUPAC name of N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine (CID 134966651) is N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine is C/C=C/C1=CC(NC(C)C)=CCC1.
What is the InChIKey of N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine?
The InChIKey is SFTQRGCWSITWRI-GQCTYLIASA-N. The full InChI is InChI=1S/C12H19N/c1-4-6-11-7-5-8-12(9-11)13-10(2)3/h4,6,8-10,13H,5,7H2,1-3H3/b6-4+.
What are the key properties of N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine?
N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine has a molecular weight of 177.29 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-5-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 134966651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).