C17H28O2Si — CID 134966868
[6,7-bis(methoxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]-trimethylsilane (PubChem CID 134966868) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is [6,7-bis(methoxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]-trimethylsilane.
| Compound Name | [6,7-bis(methoxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134966868 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | [6,7-bis(methoxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]-trimethylsilane |
| SMILES | COCC1=C(COC)CC2=C(CC=C([Si](C)(C)C)C2)C1 |
| InChI | InChI=1S/C17H28O2Si/c1-18-11-15-8-13-6-7-17(20(3,4)5)10-14(13)9-16(15)12-19-2/h7H,6,8-12H2,1-5H3 |
| InChIKey | NICATZCCKKLHAF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|