C17H26O3 — CID 134966872
2,3,3-trimethylbutan-2-yl (2S)-2-(3-methoxyphenyl)propanoate (PubChem CID 134966872) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2,3,3-trimethylbutan-2-yl (2S)-2-(3-methoxyphenyl)propanoate.
| Compound Name | 2,3,3-trimethylbutan-2-yl (2S)-2-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 134966872 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2,3,3-trimethylbutan-2-yl (2S)-2-(3-methoxyphenyl)propanoate |
| SMILES | COc1cccc([C@H](C)C(=O)OC(C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O3/c1-12(13-9-8-10-14(11-13)19-7)15(18)20-17(5,6)16(2,3)4/h8-12H,1-7H3/t12-/m0/s1 |
| InChIKey | STUCSEQAFYMDGW-LBPRGKRZSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |