C12H12N2O2S — CID 134966909
4,8-dimethyl-8-oxo-8λ6-thia-4,7-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaen-3-one (PubChem CID 134966909) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4,8-dimethyl-8-oxo-8λ6-thia-4,7-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaen-3-one.
| Compound Name | 4,8-dimethyl-8-oxo-8λ6-thia-4,7-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaen-3-one |
|---|---|
| PubChem CID | 134966909 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4,8-dimethyl-8-oxo-8λ6-thia-4,7-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaen-3-one |
| SMILES | CN1CC2=C(C1=O)c1ccccc1S(C)(=O)=N2 |
| InChI | InChI=1S/C12H12N2O2S/c1-14-7-9-11(12(14)15)8-5-3-4-6-10(8)17(2,16)13-9/h3-6H,7H2,1-2H3 |
| InChIKey | HANJWCOCOQIZEA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |