C12H20F3NO — CID 134967146
N-[(2S)-4-cyclohexyl-1,1,1-trifluorobutan-2-yl]acetamide (PubChem CID 134967146) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(2S)-4-cyclohexyl-1,1,1-trifluorobutan-2-yl]acetamide.
| Compound Name | N-[(2S)-4-cyclohexyl-1,1,1-trifluorobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 134967146 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[(2S)-4-cyclohexyl-1,1,1-trifluorobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CCC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO/c1-9(17)16-11(12(13,14)15)8-7-10-5-3-2-4-6-10/h10-11H,2-8H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | WUHZEBUSOHVGLP-NSHDSACASA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |