C9H14O2 — CID 134967150
(2R)-2-(2-methylpropyl)-2,3-dihydropyran-6-one (PubChem CID 134967150) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (2R)-2-(2-methylpropyl)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-(2-methylpropyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 134967150 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (2R)-2-(2-methylpropyl)-2,3-dihydropyran-6-one |
| SMILES | CC(C)C[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C9H14O2/c1-7(2)6-8-4-3-5-9(10)11-8/h3,5,7-8H,4,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | OLMFREJGYCNLOQ-QMMMGPOBSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |