C13H12F3NOS — CID 134967177
4-methoxy-N-[(1R)-2,2,2-trifluoro-1-thiophen-2-ylethyl]aniline (PubChem CID 134967177) has the molecular formula C13H12F3NOS and a molecular weight of 287.31 g/mol. Its IUPAC name is 4-methoxy-N-[(1R)-2,2,2-trifluoro-1-thiophen-2-ylethyl]aniline.
| Compound Name | 4-methoxy-N-[(1R)-2,2,2-trifluoro-1-thiophen-2-ylethyl]aniline |
|---|---|
| PubChem CID | 134967177 |
| Molecular Formula | C13H12F3NOS |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-methoxy-N-[(1R)-2,2,2-trifluoro-1-thiophen-2-ylethyl]aniline |
| SMILES | COc1ccc(N[C@@H](c2cccs2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F3NOS/c1-18-10-6-4-9(5-7-10)17-12(13(14,15)16)11-3-2-8-19-11/h2-8,12,17H,1H3/t12-/m0/s1 |
| InChIKey | MZMHYOUVMCGAKR-LBPRGKRZSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|