C12H17N3O2 — CID 134967257
methyl (2R,3R,4R,5R)-3,4-diamino-5-phenylpyrrolidine-2-carboxylate (PubChem CID 134967257) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is methyl (2R,3R,4R,5R)-3,4-diamino-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3R,4R,5R)-3,4-diamino-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134967257 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | methyl (2R,3R,4R,5R)-3,4-diamino-5-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2ccccc2)[C@H](N)[C@H]1N |
| InChI | InChI=1S/C12H17N3O2/c1-17-12(16)11-9(14)8(13)10(15-11)7-5-3-2-4-6-7/h2-6,8-11,15H,13-14H2,1H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | VSLDTIMSYIHFTC-GWOFURMSSA-N |
| XLogP | -0.47 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |