About (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane
(2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane (PubChem CID 134967526) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane |
| PubChem CID | 134967526 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane |
| SMILES | CC(C)C[C@H]1OC[C@@](C)(c2ccccc2)O1 |
| InChI | InChI=1S/C14H20O2/c1-11(2)9-13-15-10-14(3,16-13)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | JHMPAWZQFYXSAP-KBPBESRZSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane?
The IUPAC name of (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane (CID 134967526) is (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane.
What is the SMILES notation for (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane?
The canonical SMILES for (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane is CC(C)C[C@H]1OC[C@@](C)(c2ccccc2)O1.
What is the InChIKey of (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane?
The InChIKey is JHMPAWZQFYXSAP-KBPBESRZSA-N. The full InChI is InChI=1S/C14H20O2/c1-11(2)9-13-15-10-14(3,16-13)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/t13-,14-/m0/s1.
What are the key properties of (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane?
(2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane has a molecular weight of 220.31 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-methyl-2-(2-methylpropyl)-4-phenyl-1,3-dioxolane is sourced from PubChem (CID 134967526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).