About (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene
(1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene (PubChem CID 134967678) has the molecular formula C12H11F3O
and a molecular weight of 228.21 g/mol. Its IUPAC name is (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 134967678 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene |
| SMILES | C=C[C@@H]1OCCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H11F3O/c1-2-11-10-7-9(12(13,14)15)4-3-8(10)5-6-16-11/h2-4,7,11H,1,5-6H2/t11-/m0/s1 |
| InChIKey | GQTATXJGBFWUDR-NSHDSACASA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene (CID 134967678) is (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene is C=C[C@@H]1OCCc2ccc(C(F)(F)F)cc21.
What is the InChIKey of (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The InChIKey is GQTATXJGBFWUDR-NSHDSACASA-N. The full InChI is InChI=1S/C12H11F3O/c1-2-11-10-7-9(12(13,14)15)4-3-8(10)5-6-16-11/h2-4,7,11H,1,5-6H2/t11-/m0/s1.
What are the key properties of (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
(1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene has a molecular weight of 228.21 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-ethenyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 134967678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).