About (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol
(4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol (PubChem CID 134967846) has the molecular formula C17H34OSi
and a molecular weight of 282.54 g/mol. Its IUPAC name is (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol.
Molecular Properties
| Compound Name | (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol |
| PubChem CID | 134967846 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol |
| SMILES | CCCCCCCC[C@@H](O)C(C)(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-7-8-9-10-11-12-13-16(18)17(2,3)14-15-19(4,5)6/h16,18H,7-13H2,1-6H3/t16-/m1/s1 |
| InChIKey | FODOXKZGCDEHFD-MRXNPFEDSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol?
The IUPAC name of (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol (CID 134967846) is (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol.
What is the SMILES notation for (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol?
The canonical SMILES for (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol is CCCCCCCC[C@@H](O)C(C)(C)C#C[Si](C)(C)C.
What is the InChIKey of (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol?
The InChIKey is FODOXKZGCDEHFD-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H34OSi/c1-7-8-9-10-11-12-13-16(18)17(2,3)14-15-19(4,5)6/h16,18H,7-13H2,1-6H3/t16-/m1/s1.
What are the key properties of (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol?
(4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol has a molecular weight of 282.54 g/mol, XLogP of 5.00, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,3-dimethyl-1-trimethylsilyldodec-1-yn-4-ol is sourced from PubChem (CID 134967846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).