C18H34OSi — CID 134967878
(4R,6S)-3,3,6,10-tetramethyl-1-trimethylsilylundec-9-en-1-yn-4-ol (PubChem CID 134967878) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is (4R,6S)-3,3,6,10-tetramethyl-1-trimethylsilylundec-9-en-1-yn-4-ol.
| Compound Name | (4R,6S)-3,3,6,10-tetramethyl-1-trimethylsilylundec-9-en-1-yn-4-ol |
|---|---|
| PubChem CID | 134967878 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (4R,6S)-3,3,6,10-tetramethyl-1-trimethylsilylundec-9-en-1-yn-4-ol |
| SMILES | CC(C)=CCC[C@H](C)C[C@@H](O)C(C)(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-15(2)10-9-11-16(3)14-17(19)18(4,5)12-13-20(6,7)8/h10,16-17,19H,9,11,14H2,1-8H3/t16-,17+/m0/s1 |
| InChIKey | GJUGNFZWHCQHGH-DLBZAZTESA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|