C18H25N — CID 134967891
(2R)-2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]-2,3-dihydro-1H-indole (PubChem CID 134967891) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is (2R)-2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]-2,3-dihydro-1H-indole.
| Compound Name | (2R)-2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 134967891 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (2R)-2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]-2,3-dihydro-1H-indole |
| SMILES | C=C[C@](C)(CCC=C(C)C)[C@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C18H25N/c1-5-18(4,12-8-9-14(2)3)17-13-15-10-6-7-11-16(15)19-17/h5-7,9-11,17,19H,1,8,12-13H2,2-4H3/t17-,18-/m1/s1 |
| InChIKey | YGOZMIZFKTUYSH-QZTJIDSGSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|