About 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene
2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene (PubChem CID 134967931) has the molecular formula C16H23BrO
and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene.
Molecular Properties
| Compound Name | 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene |
| PubChem CID | 134967931 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene |
| SMILES | CC[C@]1(CCc2ccccc2)C[C@@H](COC)[C@@H]1Br |
| InChI | InChI=1S/C16H23BrO/c1-3-16(11-14(12-18-2)15(16)17)10-9-13-7-5-4-6-8-13/h4-8,14-15H,3,9-12H2,1-2H3/t14-,15-,16-/m0/s1 |
| InChIKey | CJPGBZSORBCDDC-JYJNAYRXSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene?
The IUPAC name of 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene (CID 134967931) is 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene.
What is the SMILES notation for 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene?
The canonical SMILES for 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene is CC[C@]1(CCc2ccccc2)C[C@@H](COC)[C@@H]1Br.
What is the InChIKey of 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene?
The InChIKey is CJPGBZSORBCDDC-JYJNAYRXSA-N. The full InChI is InChI=1S/C16H23BrO/c1-3-16(11-14(12-18-2)15(16)17)10-9-13-7-5-4-6-8-13/h4-8,14-15H,3,9-12H2,1-2H3/t14-,15-,16-/m0/s1.
What are the key properties of 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene?
2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene has a molecular weight of 311.26 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S,3S)-2-bromo-1-ethyl-3-(methoxymethyl)cyclobutyl]ethylbenzene is sourced from PubChem (CID 134967931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).