C12H10N2O2 — CID 134968069
3-(2-oxospiro[indole-3,2'-oxirane]-1-yl)propanenitrile (PubChem CID 134968069) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(2-oxospiro[indole-3,2'-oxirane]-1-yl)propanenitrile.
| Compound Name | 3-(2-oxospiro[indole-3,2'-oxirane]-1-yl)propanenitrile |
|---|---|
| PubChem CID | 134968069 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(2-oxospiro[indole-3,2'-oxirane]-1-yl)propanenitrile |
| SMILES | N#CCCN1C(=O)C2(CO2)c2ccccc21 |
| InChI | InChI=1S/C12H10N2O2/c13-6-3-7-14-10-5-2-1-4-9(10)12(8-16-12)11(14)15/h1-2,4-5H,3,7-8H2 |
| InChIKey | NADXBGUJRXKDAU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|