C22H21N3O2 — CID 1349681
N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine (PubChem CID 1349681) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 1349681 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)ncn3-c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H21N3O2/c1-26-21-11-8-16(12-22(21)27-2)14-23-17-9-10-20-19(13-17)24-15-25(20)18-6-4-3-5-7-18/h3-13,15,23H,14H2,1-2H3 |
| InChIKey | OOKFRASIHFMNAG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_bim(9)', 'substructure': 'N/A'} |
|---|