C17H17NO — CID 134968167
(4R,6S)-2-methyl-4,6-diphenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 134968167) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (4R,6S)-2-methyl-4,6-diphenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | (4R,6S)-2-methyl-4,6-diphenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 134968167 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (4R,6S)-2-methyl-4,6-diphenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CC1=N[C@@H](c2ccccc2)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H17NO/c1-13-18-16(14-8-4-2-5-9-14)12-17(19-13)15-10-6-3-7-11-15/h2-11,16-17H,12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | HYCOSHJGDWWECF-SJORKVTESA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |