About [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate
[(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 134968181) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
Molecular Properties
| Compound Name | [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| PubChem CID | 134968181 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C/C=C/[C@H](C)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO4/c1-6-7-9(2)16-10(14)8-13-11(15)17-12(3,4)5/h6-7,9H,8H2,1-5H3,(H,13,15)/b7-6+/t9-/m0/s1 |
| InChIKey | GZXYRSFBFTXIGZ-UCUJLANTSA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The IUPAC name of [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CID 134968181) is [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
What is the SMILES notation for [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The canonical SMILES for [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate is C/C=C/[C@H](C)OC(=O)CNC(=O)OC(C)(C)C.
What is the InChIKey of [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The InChIKey is GZXYRSFBFTXIGZ-UCUJLANTSA-N. The full InChI is InChI=1S/C12H21NO4/c1-6-7-9(2)16-10(14)8-13-11(15)17-12(3,4)5/h6-7,9H,8H2,1-5H3,(H,13,15)/b7-6+/t9-/m0/s1.
What are the key properties of [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
[(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate has a molecular weight of 243.30 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate is sourced from PubChem (CID 134968181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).