About 10b,10c-dihydropyren-1-ylmethanol
10b,10c-dihydropyren-1-ylmethanol (PubChem CID 134968186) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 10b,10c-dihydropyren-1-ylmethanol.
Molecular Properties
| Compound Name | 10b,10c-dihydropyren-1-ylmethanol |
| PubChem CID | 134968186 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 10b,10c-dihydropyren-1-ylmethanol |
| SMILES | OCC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34 |
| InChI | InChI=1S/C17H14O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9,16-18H,10H2 |
| InChIKey | NWTFUCQWUFGPPM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10b,10c-dihydropyren-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10b,10c-dihydropyren-1-ylmethanol?
The IUPAC name of 10b,10c-dihydropyren-1-ylmethanol (CID 134968186) is 10b,10c-dihydropyren-1-ylmethanol.
What is the SMILES notation for 10b,10c-dihydropyren-1-ylmethanol?
The canonical SMILES for 10b,10c-dihydropyren-1-ylmethanol is OCC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34.
What is the InChIKey of 10b,10c-dihydropyren-1-ylmethanol?
The InChIKey is NWTFUCQWUFGPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9,16-18H,10H2.
What are the key properties of 10b,10c-dihydropyren-1-ylmethanol?
10b,10c-dihydropyren-1-ylmethanol has a molecular weight of 234.30 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10b,10c-dihydropyren-1-ylmethanol is sourced from PubChem (CID 134968186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).