C13H13F3O4 — CID 134968200
ethyl (2Z)-2-[(3aR,7aR)-5-oxo-7a-(trifluoromethyl)-3a,4-dihydro-1-benzofuran-3-ylidene]acetate (PubChem CID 134968200) has the molecular formula C13H13F3O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3aR,7aR)-5-oxo-7a-(trifluoromethyl)-3a,4-dihydro-1-benzofuran-3-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3aR,7aR)-5-oxo-7a-(trifluoromethyl)-3a,4-dihydro-1-benzofuran-3-ylidene]acetate |
|---|---|
| PubChem CID | 134968200 |
| Molecular Formula | C13H13F3O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | ethyl (2Z)-2-[(3aR,7aR)-5-oxo-7a-(trifluoromethyl)-3a,4-dihydro-1-benzofuran-3-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CO[C@]2(C(F)(F)F)C=CC(=O)C[C@H]12 |
| InChI | InChI=1S/C13H13F3O4/c1-2-19-11(18)5-8-7-20-12(13(14,15)16)4-3-9(17)6-10(8)12/h3-5,10H,2,6-7H2,1H3/b8-5+/t10-,12-/m1/s1 |
| InChIKey | JXBHGIBIOQGPGN-GINUYBFQSA-N |
| XLogP | 1.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|