C12H19NO2 — CID 134968213
(7R,7aS)-7-ethylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one (PubChem CID 134968213) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (7R,7aS)-7-ethylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one.
| Compound Name | (7R,7aS)-7-ethylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one |
|---|---|
| PubChem CID | 134968213 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (7R,7aS)-7-ethylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one |
| SMILES | CC[C@@H]1CC(=O)N2[C@@H]1COC21CCCC1 |
| InChI | InChI=1S/C12H19NO2/c1-2-9-7-11(14)13-10(9)8-15-12(13)5-3-4-6-12/h9-10H,2-8H2,1H3/t9-,10-/m1/s1 |
| InChIKey | JJHOXYOPMHHGDI-NXEZZACHSA-N |
| XLogP | 1.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |