About N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide
N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide (PubChem CID 134968269) has the molecular formula C12H14F3NO2
and a molecular weight of 261.24 g/mol. Its IUPAC name is N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide |
| PubChem CID | 134968269 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(C)(O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO2/c1-8(17)16-10-5-3-9(4-6-10)11(2,18)7-12(13,14)15/h3-6,18H,7H2,1-2H3,(H,16,17) |
| InChIKey | MSUURYFHVFIBRG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide?
The IUPAC name of N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide (CID 134968269) is N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide?
The canonical SMILES for N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide is CC(=O)Nc1ccc(C(C)(O)CC(F)(F)F)cc1.
What is the InChIKey of N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide?
The InChIKey is MSUURYFHVFIBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3NO2/c1-8(17)16-10-5-3-9(4-6-10)11(2,18)7-12(13,14)15/h3-6,18H,7H2,1-2H3,(H,16,17).
What are the key properties of N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide?
N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide has a molecular weight of 261.24 g/mol, XLogP of 2.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4,4,4-trifluoro-2-hydroxybutan-2-yl)phenyl]acetamide is sourced from PubChem (CID 134968269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).