C16H36N2 — CID 134968490
(2S)-3,3-dimethyl-1-N,1-N-di(pentan-3-yl)butane-1,2-diamine (PubChem CID 134968490) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-1-N,1-N-di(pentan-3-yl)butane-1,2-diamine.
| Compound Name | (2S)-3,3-dimethyl-1-N,1-N-di(pentan-3-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 134968490 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | (2S)-3,3-dimethyl-1-N,1-N-di(pentan-3-yl)butane-1,2-diamine |
| SMILES | CCC(CC)N(C[C@@H](N)C(C)(C)C)C(CC)CC |
| InChI | InChI=1S/C16H36N2/c1-8-13(9-2)18(14(10-3)11-4)12-15(17)16(5,6)7/h13-15H,8-12,17H2,1-7H3/t15-/m1/s1 |
| InChIKey | PLQVUYZVSCRIPA-OAHLLOKOSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |