C10H13NO — CID 134968632
(2S,3R)-3-pyridin-3-ylpent-4-en-2-ol (PubChem CID 134968632) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2S,3R)-3-pyridin-3-ylpent-4-en-2-ol.
| Compound Name | (2S,3R)-3-pyridin-3-ylpent-4-en-2-ol |
|---|---|
| PubChem CID | 134968632 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2S,3R)-3-pyridin-3-ylpent-4-en-2-ol |
| SMILES | C=C[C@H](c1cccnc1)[C@H](C)O |
| InChI | InChI=1S/C10H13NO/c1-3-10(8(2)12)9-5-4-6-11-7-9/h3-8,10,12H,1H2,2H3/t8-,10-/m0/s1 |
| InChIKey | IWEOWYYHHSEZPV-WPRPVWTQSA-N |
| XLogP | 1.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|