C16H19BrO2 — CID 134968985
(1R,2S)-5-bromo-2-(hydroxymethyl)-2-(4-methylpenta-1,3-dien-3-yl)-1,3-dihydroinden-1-ol (PubChem CID 134968985) has the molecular formula C16H19BrO2 and a molecular weight of 323.23 g/mol. Its IUPAC name is (1R,2S)-5-bromo-2-(hydroxymethyl)-2-(4-methylpenta-1,3-dien-3-yl)-1,3-dihydroinden-1-ol.
| Compound Name | (1R,2S)-5-bromo-2-(hydroxymethyl)-2-(4-methylpenta-1,3-dien-3-yl)-1,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 134968985 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (1R,2S)-5-bromo-2-(hydroxymethyl)-2-(4-methylpenta-1,3-dien-3-yl)-1,3-dihydroinden-1-ol |
| SMILES | C=CC(=C(C)C)[C@]1(CO)Cc2cc(Br)ccc2[C@H]1O |
| InChI | InChI=1S/C16H19BrO2/c1-4-14(10(2)3)16(9-18)8-11-7-12(17)5-6-13(11)15(16)19/h4-7,15,18-19H,1,8-9H2,2-3H3/t15-,16-/m1/s1 |
| InChIKey | WUWGKQRKGONVAC-HZPDHXFCSA-N |
| XLogP | 3.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|