C11H15NO — CID 134969028
2-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-one (PubChem CID 134969028) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-one.
| Compound Name | 2-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-one |
|---|---|
| PubChem CID | 134969028 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-one |
| SMILES | CN1CC=CC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C11H15NO/c1-12-8-4-6-9-5-2-3-7-10(9)11(12)13/h4,6H,2-3,5,7-8H2,1H3 |
| InChIKey | ZOSKSVCMWOBODQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |