C10H18O2 — CID 134969158
(3R,4R)-3,7-dimethylocta-1,6-diene-3,4-diol (PubChem CID 134969158) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3R,4R)-3,7-dimethylocta-1,6-diene-3,4-diol.
| Compound Name | (3R,4R)-3,7-dimethylocta-1,6-diene-3,4-diol |
|---|---|
| PubChem CID | 134969158 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3R,4R)-3,7-dimethylocta-1,6-diene-3,4-diol |
| SMILES | C=C[C@@](C)(O)[C@H](O)CC=C(C)C |
| InChI | InChI=1S/C10H18O2/c1-5-10(4,12)9(11)7-6-8(2)3/h5-6,9,11-12H,1,7H2,2-4H3/t9-,10-/m1/s1 |
| InChIKey | YDGOIHYUXBNION-NXEZZACHSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|