C12H21F3O — CID 134969182
(3S,4R)-3-(2,2,2-trifluoroethyl)dec-1-en-4-ol (PubChem CID 134969182) has the molecular formula C12H21F3O and a molecular weight of 238.29 g/mol. Its IUPAC name is (3S,4R)-3-(2,2,2-trifluoroethyl)dec-1-en-4-ol.
| Compound Name | (3S,4R)-3-(2,2,2-trifluoroethyl)dec-1-en-4-ol |
|---|---|
| PubChem CID | 134969182 |
| Molecular Formula | C12H21F3O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (3S,4R)-3-(2,2,2-trifluoroethyl)dec-1-en-4-ol |
| SMILES | C=C[C@H](CC(F)(F)F)[C@H](O)CCCCCC |
| InChI | InChI=1S/C12H21F3O/c1-3-5-6-7-8-11(16)10(4-2)9-12(13,14)15/h4,10-11,16H,2-3,5-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | LLABKQUQBISQCZ-GHMZBOCLSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|