C33H50O2Si — CID 134969241
tert-butyl-[(2S)-2-[(2R,5S,6S)-5-methyl-6-[(E)-5-methylhex-3-en-2-yl]oxan-2-yl]butoxy]-diphenylsilane (PubChem CID 134969241) has the molecular formula C33H50O2Si and a molecular weight of 506.85 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(2R,5S,6S)-5-methyl-6-[(E)-5-methylhex-3-en-2-yl]oxan-2-yl]butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(2R,5S,6S)-5-methyl-6-[(E)-5-methylhex-3-en-2-yl]oxan-2-yl]butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134969241 |
| Molecular Formula | C33H50O2Si |
| Molecular Weight | 506.85 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | tert-butyl-[(2S)-2-[(2R,5S,6S)-5-methyl-6-[(E)-5-methylhex-3-en-2-yl]oxan-2-yl]butoxy]-diphenylsilane |
| SMILES | CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CC[C@H](C)[C@@H](C(C)/C=C/C(C)C)O1 |
| InChI | InChI=1S/C33H50O2Si/c1-9-28(31-23-22-27(5)32(35-31)26(4)21-20-25(2)3)24-34-36(33(6,7)8,29-16-12-10-13-17-29)30-18-14-11-15-19-30/h10-21,25-28,31-32H,9,22-24H2,1-8H3/b21-20+/t26?,27-,28-,31+,32+/m0/s1 |
| InChIKey | DJSUYLCDIABHJD-WRHGXILKSA-N |
| XLogP | 7.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.85 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|