C16H24O2 — CID 134969412
(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one (PubChem CID 134969412) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one.
| Compound Name | (3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
|---|---|
| PubChem CID | 134969412 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
| SMILES | C=CC1C2C(CC)C[C@@]3(CC)OC(=O)[C@]1(CC)C23 |
| InChI | InChI=1S/C16H24O2/c1-5-10-9-15(7-3)13-12(10)11(6-2)16(13,8-4)14(17)18-15/h6,10-13H,2,5,7-9H2,1,3-4H3/t10?,11?,12?,13?,15-,16+/m1/s1 |
| InChIKey | YNZZVHKMSJDZGX-VBQOFZJKSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|