C13H18O2 — CID 134969426
1-[(1S,7R)-9-methyl-11-oxatricyclo[5.3.1.02,6]undec-8-en-2-yl]ethanone (PubChem CID 134969426) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-[(1S,7R)-9-methyl-11-oxatricyclo[5.3.1.02,6]undec-8-en-2-yl]ethanone.
| Compound Name | 1-[(1S,7R)-9-methyl-11-oxatricyclo[5.3.1.02,6]undec-8-en-2-yl]ethanone |
|---|---|
| PubChem CID | 134969426 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-[(1S,7R)-9-methyl-11-oxatricyclo[5.3.1.02,6]undec-8-en-2-yl]ethanone |
| SMILES | CC(=O)C12CCCC1[C@H]1C=C(C)C[C@@H]2O1 |
| InChI | InChI=1S/C13H18O2/c1-8-6-11-10-4-3-5-13(10,9(2)14)12(7-8)15-11/h6,10-12H,3-5,7H2,1-2H3/t10?,11-,12+,13?/m1/s1 |
| InChIKey | QMIMAROLVHLXQN-QBHFIFKDSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|