C16H18O2 — CID 134969491
1-[(1S,5S,6S)-3-methyl-6-phenyl-8-oxabicyclo[3.2.1]oct-2-en-6-yl]ethanone (PubChem CID 134969491) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-[(1S,5S,6S)-3-methyl-6-phenyl-8-oxabicyclo[3.2.1]oct-2-en-6-yl]ethanone.
| Compound Name | 1-[(1S,5S,6S)-3-methyl-6-phenyl-8-oxabicyclo[3.2.1]oct-2-en-6-yl]ethanone |
|---|---|
| PubChem CID | 134969491 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-[(1S,5S,6S)-3-methyl-6-phenyl-8-oxabicyclo[3.2.1]oct-2-en-6-yl]ethanone |
| SMILES | CC(=O)[C@]1(c2ccccc2)C[C@H]2C=C(C)C[C@@H]1O2 |
| InChI | InChI=1S/C16H18O2/c1-11-8-14-10-16(12(2)17,15(9-11)18-14)13-6-4-3-5-7-13/h3-8,14-15H,9-10H2,1-2H3/t14-,15+,16+/m1/s1 |
| InChIKey | ULXGQITWTZKJOS-PMPSAXMXSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|