C19H38O4Si — CID 134969675
1-[(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]propan-2-one (PubChem CID 134969675) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is 1-[(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]propan-2-one.
| Compound Name | 1-[(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 134969675 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]propan-2-one |
| SMILES | COC1(CC(C)=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C19H38O4Si/c1-13(2)17-15(4)16(23-24(9,10)18(5,6)7)12-19(21-8,22-17)11-14(3)20/h13,15-17H,11-12H2,1-10H3/t15-,16+,17+,19?/m0/s1 |
| InChIKey | UNQOLTBCZOOCCO-GDFJXRMTSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|