C30H34IO5P — CID 134969694
iodo-triphenyl-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-λ5-phosphane (PubChem CID 134969694) has the molecular formula C30H34IO5P and a molecular weight of 632.48 g/mol. Its IUPAC name is iodo-triphenyl-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-λ5-phosphane.
| Compound Name | iodo-triphenyl-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-λ5-phosphane |
|---|---|
| PubChem CID | 134969694 |
| Molecular Formula | C30H34IO5P |
| Molecular Weight | 632.48 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | iodo-triphenyl-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-λ5-phosphane |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(CP(I)(c3ccccc3)(c3ccccc3)c3ccccc3)O[C@@H]2O1 |
| InChI | InChI=1S/C30H34IO5P/c1-29(2)33-25-24(32-28-27(26(25)34-29)35-30(3,4)36-28)20-37(31,21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19,24-28H,20H2,1-4H3/t24?,25-,26?,27?,28+/m0/s1 |
| InChIKey | MDFBRSRTTXUPOR-MCPTVWALSA-N |
| XLogP | 5.26 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|